C21H27NO6 — CID 70671313
(1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid (PubChem CID 70671313) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid.
| Compound Name | (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 70671313 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2(C(=O)O)N1C(=O)[C@@H]1CC(OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C21H27NO6/c1-19(2,3)17-22-16(23)14-10-15(26-11-13-8-6-5-7-9-13)28-20(14,4)21(22,12-27-17)18(24)25/h5-9,14-15,17H,10-12H2,1-4H3,(H,24,25)/t14-,15?,17-,20-,21+/m0/s1 |
| InChIKey | PLGDLXDLXYTFMB-SOYOUEONSA-N |
| XLogP | 2.39 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |