C25H22ClNO3 — CID 70671581
methyl 4-[4-(3-chlorophenyl)phenyl]-2-methyl-7-methylidene-5-oxo-4,8-dihydro-1H-quinoline-3-carboxylate (PubChem CID 70671581) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is methyl 4-[4-(3-chlorophenyl)phenyl]-2-methyl-7-methylidene-5-oxo-4,8-dihydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl 4-[4-(3-chlorophenyl)phenyl]-2-methyl-7-methylidene-5-oxo-4,8-dihydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 70671581 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | methyl 4-[4-(3-chlorophenyl)phenyl]-2-methyl-7-methylidene-5-oxo-4,8-dihydro-1H-quinoline-3-carboxylate |
| SMILES | C=C1CC(=O)C2=C(C1)NC(C)=C(C(=O)OC)C2c1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H22ClNO3/c1-14-11-20-24(21(28)12-14)23(22(15(2)27-20)25(29)30-3)17-9-7-16(8-10-17)18-5-4-6-19(26)13-18/h4-10,13,23,27H,1,11-12H2,2-3H3 |
| InChIKey | IZLCEQINKASFAH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|