C26H39FO7 — CID 70671788
benzyl (6S,7aR)-4-[(1R)-1,2-dibutoxyethyl]-6-fluoro-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate (PubChem CID 70671788) has the molecular formula C26H39FO7 and a molecular weight of 482.59 g/mol. Its IUPAC name is benzyl (6S,7aR)-4-[(1R)-1,2-dibutoxyethyl]-6-fluoro-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate.
| Compound Name | benzyl (6S,7aR)-4-[(1R)-1,2-dibutoxyethyl]-6-fluoro-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 70671788 |
| Molecular Formula | C26H39FO7 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | benzyl (6S,7aR)-4-[(1R)-1,2-dibutoxyethyl]-6-fluoro-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-carboxylate |
| SMILES | CCCCOC[C@@H](OCCCC)C1O[C@@](F)(C(=O)OCc2ccccc2)C[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C26H39FO7/c1-5-7-14-29-18-21(30-15-8-6-2)23-22-20(32-25(3,4)33-22)16-26(27,34-23)24(28)31-17-19-12-10-9-11-13-19/h9-13,20-23H,5-8,14-18H2,1-4H3/t20-,21-,22?,23?,26-/m1/s1 |
| InChIKey | QBOPYDLMNWOEQR-ISZYJOAASA-N |
| XLogP | 4.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|