C19H17IN4OS — CID 70671871
4-[[(1R,2R)-2-hydroxy-1-(5-phenyl-1,3,4-thiadiazol-2-yl)propyl]amino]-2-iodo-3-methylbenzonitrile (PubChem CID 70671871) has the molecular formula C19H17IN4OS and a molecular weight of 476.34 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-hydroxy-1-(5-phenyl-1,3,4-thiadiazol-2-yl)propyl]amino]-2-iodo-3-methylbenzonitrile.
| Compound Name | 4-[[(1R,2R)-2-hydroxy-1-(5-phenyl-1,3,4-thiadiazol-2-yl)propyl]amino]-2-iodo-3-methylbenzonitrile |
|---|---|
| PubChem CID | 70671871 |
| Molecular Formula | C19H17IN4OS |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 4-[[(1R,2R)-2-hydroxy-1-(5-phenyl-1,3,4-thiadiazol-2-yl)propyl]amino]-2-iodo-3-methylbenzonitrile |
| SMILES | Cc1c(N[C@@H](c2nnc(-c3ccccc3)s2)[C@@H](C)O)ccc(C#N)c1I |
| InChI | InChI=1S/C19H17IN4OS/c1-11-15(9-8-14(10-21)16(11)20)22-17(12(2)25)19-24-23-18(26-19)13-6-4-3-5-7-13/h3-9,12,17,22,25H,1-2H3/t12-,17-/m1/s1 |
| InChIKey | ZXUZZJKEKMWEDX-SJKOYZFVSA-N |
| XLogP | 4.52 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|