C21H21ClFN3O4S — CID 70672043
6-butoxy-N-[3-(4-chloro-3-fluorophenyl)-2-oxopropyl]-2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-7-carboxamide (PubChem CID 70672043) has the molecular formula C21H21ClFN3O4S and a molecular weight of 465.93 g/mol. Its IUPAC name is 6-butoxy-N-[3-(4-chloro-3-fluorophenyl)-2-oxopropyl]-2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-7-carboxamide.
| Compound Name | 6-butoxy-N-[3-(4-chloro-3-fluorophenyl)-2-oxopropyl]-2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 70672043 |
| Molecular Formula | C21H21ClFN3O4S |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 6-butoxy-N-[3-(4-chloro-3-fluorophenyl)-2-oxopropyl]-2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-7-carboxamide |
| SMILES | CCCCOc1c(C(=O)NCC(=O)Cc2ccc(Cl)c(F)c2)nc2sc(C)cn2c1=O |
| InChI | InChI=1S/C21H21ClFN3O4S/c1-3-4-7-30-18-17(25-21-26(20(18)29)11-12(2)31-21)19(28)24-10-14(27)8-13-5-6-15(22)16(23)9-13/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,24,28) |
| InChIKey | IZECFHBPYVSEPA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|