C25H33FN2O2 — CID 70672425
(7S,8aR,10aR)-8a-(fluoromethyl)-1,1,4a-trimethyl-2,6-dioxo-7-(piperidin-1-ylmethyl)-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile (PubChem CID 70672425) has the molecular formula C25H33FN2O2 and a molecular weight of 412.55 g/mol. Its IUPAC name is (7S,8aR,10aR)-8a-(fluoromethyl)-1,1,4a-trimethyl-2,6-dioxo-7-(piperidin-1-ylmethyl)-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile.
| Compound Name | (7S,8aR,10aR)-8a-(fluoromethyl)-1,1,4a-trimethyl-2,6-dioxo-7-(piperidin-1-ylmethyl)-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 70672425 |
| Molecular Formula | C25H33FN2O2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (7S,8aR,10aR)-8a-(fluoromethyl)-1,1,4a-trimethyl-2,6-dioxo-7-(piperidin-1-ylmethyl)-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=CC2(C)C3=CC(=O)[C@H](CN4CCCCC4)C[C@]3(CF)CC[C@@H]12 |
| InChI | InChI=1S/C25H33FN2O2/c1-23(2)20-7-8-25(16-26)13-18(15-28-9-5-4-6-10-28)19(29)11-21(25)24(20,3)12-17(14-27)22(23)30/h11-12,18,20H,4-10,13,15-16H2,1-3H3/t18-,20-,24?,25-/m0/s1 |
| InChIKey | PLJDBJBCSLVANP-UGGKSWNVSA-N |
| XLogP | 4.42 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |