C23H38O — CID 70672671
(4aS,7S,8R,10aR)-8-butyl-1,1,4a,7,8a-pentamethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one (PubChem CID 70672671) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (4aS,7S,8R,10aR)-8-butyl-1,1,4a,7,8a-pentamethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one.
| Compound Name | (4aS,7S,8R,10aR)-8-butyl-1,1,4a,7,8a-pentamethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 70672671 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (4aS,7S,8R,10aR)-8-butyl-1,1,4a,7,8a-pentamethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one |
| SMILES | CCCC[C@@H]1[C@@H](C)CC=C2C1(C)CC[C@H]1C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C23H38O/c1-7-8-9-17-16(2)10-11-19-22(17,5)14-12-18-21(3,4)20(24)13-15-23(18,19)6/h11,16-18H,7-10,12-15H2,1-6H3/t16-,17+,18-,22?,23-/m0/s1 |
| InChIKey | JRBYOTAQVLFKHE-YQUHCCPFSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|