C20H37NOSi — CID 70672927
(4R,6S)-4,5,5-trimethyl-6-[tri(propan-2-yl)silyloxymethyl]bicyclo[2.1.1]hexane-1-carbonitrile (PubChem CID 70672927) has the molecular formula C20H37NOSi and a molecular weight of 335.61 g/mol. Its IUPAC name is (4R,6S)-4,5,5-trimethyl-6-[tri(propan-2-yl)silyloxymethyl]bicyclo[2.1.1]hexane-1-carbonitrile.
| Compound Name | (4R,6S)-4,5,5-trimethyl-6-[tri(propan-2-yl)silyloxymethyl]bicyclo[2.1.1]hexane-1-carbonitrile |
|---|---|
| PubChem CID | 70672927 |
| Molecular Formula | C20H37NOSi |
| Molecular Weight | 335.61 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (4R,6S)-4,5,5-trimethyl-6-[tri(propan-2-yl)silyloxymethyl]bicyclo[2.1.1]hexane-1-carbonitrile |
| SMILES | CC(C)[Si](OC[C@@H]1C2(C#N)CC[C@@]1(C)C2(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H37NOSi/c1-14(2)23(15(3)4,16(5)6)22-12-17-19(9)10-11-20(17,13-21)18(19,7)8/h14-17H,10-12H2,1-9H3/t17-,19+,20?/m0/s1 |
| InChIKey | NITRLICADCAXKR-XRRBNZLQSA-N |
| XLogP | 6.14 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|