C28H26ClF2N7OS — CID 70673185
[3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone (PubChem CID 70673185) has the molecular formula C28H26ClF2N7OS and a molecular weight of 582.08 g/mol. Its IUPAC name is [3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 70673185 |
| Molecular Formula | C28H26ClF2N7OS |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | [3-[2-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-1,3-thiazol-4-yl]phenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cccc(-c2csc(-c3cnc4c(n3)N(Cc3c(F)ccc(F)c3Cl)CCCN4)n2)c1)N1CCNCC1 |
| InChI | InChI=1S/C28H26ClF2N7OS/c29-24-19(20(30)5-6-21(24)31)15-38-10-2-7-33-25-26(38)35-22(14-34-25)27-36-23(16-40-27)17-3-1-4-18(13-17)28(39)37-11-8-32-9-12-37/h1,3-6,13-14,16,32H,2,7-12,15H2,(H,33,34) |
| InChIKey | HBZLFADXXOSOKU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|