About 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine
3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 70673555) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 70673555 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COCC1CNc2ncccc21 |
| InChI | InChI=1S/C9H12N2O/c1-12-6-7-5-11-9-8(7)3-2-4-10-9/h2-4,7H,5-6H2,1H3,(H,10,11) |
| InChIKey | UOZNLDHFVICRIK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 70673555) is 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is COCC1CNc2ncccc21.
What is the InChIKey of 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is UOZNLDHFVICRIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-12-6-7-5-11-9-8(7)3-2-4-10-9/h2-4,7H,5-6H2,1H3,(H,10,11).
What are the key properties of 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 164.21 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 70673555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).