4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid

C10H23NO2Si — CID 70673731

IUPAC4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid
SMILESCC(C)(C)[Si](C)(C)C(CN)CC(=O)O
InChIInChI=1S/C10H23NO2Si/c1-10(2,3)14(4,5)8(7-11)6-9(12)13/h8H,6-7,11H2,1-5H3,(H,12,13)
InChIKeyGSTCXJOOMCJDCE-UHFFFAOYSA-N
MW217.38 g/mol
LogP2.30
Rot. Bonds4

About 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid

4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid (PubChem CID 70673731) has the molecular formula C10H23NO2Si and a molecular weight of 217.38 g/mol. Its IUPAC name is 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid.

Molecular Properties

Compound Name4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid
PubChem CID70673731
Molecular FormulaC10H23NO2Si
Molecular Weight217.38 g/mol
Exact Mass217.15
IUPAC Name4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid
SMILESCC(C)(C)[Si](C)(C)C(CN)CC(=O)O
InChIInChI=1S/C10H23NO2Si/c1-10(2,3)14(4,5)8(7-11)6-9(12)13/h8H,6-7,11H2,1-5H3,(H,12,13)
InChIKeyGSTCXJOOMCJDCE-UHFFFAOYSA-N
XLogP2.30
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.38
LogP ≤ 52.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-Amino-3-[(trimethylsilyl)methyl]butanoic acid
CID 70673734
(3R)-3-(aminomethyl)-4-trimethylsilylbutanoic acid
CID 71463081
(3S)-3-(aminomethyl)-4-trimethylsilylbutanoic acid
CID 71463082
4-Amino-3-(trimethylsilyl)butanoic acid
CID 70673729
4-Amino-3-(dimethyl-n-octylsilyl)butanoic acid
CID 70673733
4-Amino-3-(1-methylsilinan-1-yl)butanoic acid
CID 70673851
4-Amino-3-[(1-methyl-1-silacyclopentan-1-yl)methyl]butanoic acid
CID 70673852
3-(Aminomethyl)-4-(1-methylsilinan-1-yl)butanoic acid
CID 70673853
4-(1-Trimethylsilylethylamino)butanoic acid
CID 88962111
4-Amino-2-trimethylsilylbutanoic acid
CID 90943054
3-(Aminomethyl)-4-[cyclopropyl(dimethyl)silyl]butanoic acid
CID 140684234
2-[Tert-butyl(dimethyl)silyl]ethyl 4-aminobutanoate
CID 141039289

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid?
The IUPAC name of 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid (CID 70673731) is 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid.
What is the SMILES notation for 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid?
The canonical SMILES for 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid is CC(C)(C)[Si](C)(C)C(CN)CC(=O)O.
What is the InChIKey of 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid?
The InChIKey is GSTCXJOOMCJDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2Si/c1-10(2,3)14(4,5)8(7-11)6-9(12)13/h8H,6-7,11H2,1-5H3,(H,12,13).
What are the key properties of 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid?
4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid has a molecular weight of 217.38 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-[tert-butyl(dimethyl)silyl]butanoic acid is sourced from PubChem (CID 70673731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).