C24H30O8 — CID 70674151
[(1R,2R,6R,10S,11R,15S,16R,17R)-6-hydroxy-8-(hydroxymethyl)-4,13,17-trimethyl-5-oxo-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadeca-3,8-dien-16-yl] acetate (PubChem CID 70674151) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(1R,2R,6R,10S,11R,15S,16R,17R)-6-hydroxy-8-(hydroxymethyl)-4,13,17-trimethyl-5-oxo-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadeca-3,8-dien-16-yl] acetate.
| Compound Name | [(1R,2R,6R,10S,11R,15S,16R,17R)-6-hydroxy-8-(hydroxymethyl)-4,13,17-trimethyl-5-oxo-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadeca-3,8-dien-16-yl] acetate |
|---|---|
| PubChem CID | 70674151 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(1R,2R,6R,10S,11R,15S,16R,17R)-6-hydroxy-8-(hydroxymethyl)-4,13,17-trimethyl-5-oxo-15-prop-1-en-2-yl-12,14,18-trioxapentacyclo[11.4.1.01,10.02,6.011,15]octadeca-3,8-dien-16-yl] acetate |
| SMILES | C=C(C)[C@@]12OC3(C)O[C@@H]1[C@@H]1C=C(CO)C[C@]4(O)C(=O)C(C)=C[C@H]4[C@@]1(O3)[C@H](C)[C@H]2OC(C)=O |
| InChI | InChI=1S/C24H30O8/c1-11(2)23-19(29-14(5)26)13(4)24-16(20(23)30-21(6,31-23)32-24)8-15(10-25)9-22(28)17(24)7-12(3)18(22)27/h7-8,13,16-17,19-20,25,28H,1,9-10H2,2-6H3/t13-,16+,17-,19-,20-,21?,22-,23+,24-/m1/s1 |
| InChIKey | PXFYLWZOFVKKBG-AOXXXCAZSA-N |
| XLogP | 1.56 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|