C31H39N5O6 — CID 70674482
7-(diethylamino)-3-[1-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]triazol-4-yl]chromen-2-one (PubChem CID 70674482) has the molecular formula C31H39N5O6 and a molecular weight of 577.68 g/mol. Its IUPAC name is 7-(diethylamino)-3-[1-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]triazol-4-yl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[1-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]triazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 70674482 |
| Molecular Formula | C31H39N5O6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 7-(diethylamino)-3-[1-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]triazol-4-yl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3cn(-c4ccc(N5CCOCCOCCOCCOCC5)cc4)nn3)c(=O)oc2c1 |
| InChI | InChI=1S/C31H39N5O6/c1-3-34(4-2)27-6-5-24-21-28(31(37)42-30(24)22-27)29-23-36(33-32-29)26-9-7-25(8-10-26)35-11-13-38-15-17-40-19-20-41-18-16-39-14-12-35/h5-10,21-23H,3-4,11-20H2,1-2H3 |
| InChIKey | OPOOAFFRFONRPC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|