C37H45N5O9 — CID 70674714
2-ethyl-6-[1-[3-(2-methoxyethoxy)-4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]triazol-4-yl]benzo[de]isoquinoline-1,3-dione (PubChem CID 70674714) has the molecular formula C37H45N5O9 and a molecular weight of 703.79 g/mol. Its IUPAC name is 2-ethyl-6-[1-[3-(2-methoxyethoxy)-4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]triazol-4-yl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-ethyl-6-[1-[3-(2-methoxyethoxy)-4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]triazol-4-yl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 70674714 |
| Molecular Formula | C37H45N5O9 |
| Molecular Weight | 703.79 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | 2-ethyl-6-[1-[3-(2-methoxyethoxy)-4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]triazol-4-yl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCN1C(=O)c2cccc3c(-c4cn(-c5ccc(N6CCOCCOCCOCCOCCOCC6)c(OCCOC)c5)nn4)ccc(c23)C1=O |
| InChI | InChI=1S/C37H45N5O9/c1-3-41-36(43)30-6-4-5-29-28(8-9-31(35(29)30)37(41)44)32-26-42(39-38-32)27-7-10-33(34(25-27)51-24-15-45-2)40-11-13-46-16-18-48-20-22-50-23-21-49-19-17-47-14-12-40/h4-10,25-26H,3,11-24H2,1-2H3 |
| InChIKey | FEZWKTRSOKZBEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 135.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|