C31H33F6NO5 — CID 70674983
3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]propanoic acid (PubChem CID 70674983) has the molecular formula C31H33F6NO5 and a molecular weight of 613.60 g/mol. Its IUPAC name is 3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 70674983 |
| Molecular Formula | C31H33F6NO5 |
| Molecular Weight | 613.60 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]propanoic acid |
| SMILES | COc1ccc(CCC(=O)O)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C31H33F6NO5/c1-17-27(19-12-21(30(32,33)34)14-22(13-19)31(35,36)37)43-28(41)38(17)16-20-15-29(2,3)10-9-23(20)24-11-18(6-8-26(39)40)5-7-25(24)42-4/h5,7,11-14,17,27H,6,8-10,15-16H2,1-4H3,(H,39,40)/t17-,27-/m0/s1 |
| InChIKey | VWLUCQLGLICSGK-SOKVYYICSA-N |
| XLogP | 8.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.60 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |