C34H40F6N2O4 — CID 70675338
3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-N,2,2-trimethylpropanamide (PubChem CID 70675338) has the molecular formula C34H40F6N2O4 and a molecular weight of 654.69 g/mol. Its IUPAC name is 3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 70675338 |
| Molecular Formula | C34H40F6N2O4 |
| Molecular Weight | 654.69 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | 3-[3-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxyphenyl]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Cc1ccc(OC)c(C2=C(CN3C(=O)O[C@H](c4cc(C(F)(F)F)cc(C(F)(F)F)c4)[C@@H]3C)CC(C)(C)CC2)c1 |
| InChI | InChI=1S/C34H40F6N2O4/c1-19-28(21-13-23(33(35,36)37)15-24(14-21)34(38,39)40)46-30(44)42(19)18-22-17-31(2,3)11-10-25(22)26-12-20(8-9-27(26)45-7)16-32(4,5)29(43)41-6/h8-9,12-15,19,28H,10-11,16-18H2,1-7H3,(H,41,43)/t19-,28-/m0/s1 |
| InChIKey | JOZIWHFQSQRHEV-VKGTZQKMSA-N |
| XLogP | 8.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.69 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |