C31H31F6N3O4 — CID 70675460
(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 70675460) has the molecular formula C31H31F6N3O4 and a molecular weight of 623.59 g/mol. Its IUPAC name is (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70675460 |
| Molecular Formula | C31H31F6N3O4 |
| Molecular Weight | 623.59 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | (4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-3-[[2-[2-methoxy-5-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]cyclohexen-1-yl]methyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(-c2nc(C(C)C)no2)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CCCC1 |
| InChI | InChI=1S/C31H31F6N3O4/c1-16(2)27-38-28(44-39-27)18-9-10-25(42-4)24(13-18)23-8-6-5-7-19(23)15-40-17(3)26(43-29(40)41)20-11-21(30(32,33)34)14-22(12-20)31(35,36)37/h9-14,16-17,26H,5-8,15H2,1-4H3/t17-,26-/m0/s1 |
| InChIKey | SJHRCILJSLJYJM-QLXKLKPCSA-N |
| XLogP | 8.82 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.59 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |