C24H32IN5O3S2 — CID 70675742
4-[7-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide iodide (PubChem CID 70675742) has the molecular formula C24H32IN5O3S2 and a molecular weight of 629.59 g/mol. Its IUPAC name is 4-[7-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide iodide.
| Compound Name | 4-[7-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide iodide |
|---|---|
| PubChem CID | 70675742 |
| Molecular Formula | C24H32IN5O3S2 |
| Molecular Weight | 629.59 g/mol |
| Exact Mass | 629.10 |
| IUPAC Name | 4-[7-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide iodide |
| SMILES | Cc1c/c(=[N+]2\C[C@@H](C)O[C@@H](C)C2)cc2sc3cc(N4CCN(S(N)(=O)=O)CC4)cc(C)c3nc1-2.[I-] |
| InChI | InChI=1S/C24H32N5O3S2.HI/c1-15-9-19(27-5-7-29(8-6-27)34(25,30)31)11-21-23(15)26-24-16(2)10-20(12-22(24)33-21)28-13-17(3)32-18(4)14-28;/h9-12,17-18H,5-8,13-14H2,1-4H3,(H2,25,30,31);1H/q+1;/p-1/t17-,18+; |
| InChIKey | PSYCRAKRBXAUBC-GNXQHMNLSA-M |
| XLogP | -1.07 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.59 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|