C24H32N5O3S2+ — CID 70675745
4-[7-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide (PubChem CID 70675745) has the molecular formula C24H32N5O3S2+ and a molecular weight of 502.69 g/mol. Its IUPAC name is 4-[7-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide.
| Compound Name | 4-[7-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 70675745 |
| Molecular Formula | C24H32N5O3S2+ |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 4-[7-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-ylidene]-1,9-dimethylphenothiazin-3-yl]piperazine-1-sulfonamide |
| SMILES | Cc1cc(=[N+]2C[C@@H](C)O[C@H](C)C2)cc2sc3cc(N4CCN(S(N)(=O)=O)CC4)cc(C)c3nc1-2 |
| InChI | InChI=1S/C24H32N5O3S2/c1-15-9-19(27-5-7-29(8-6-27)34(25,30)31)11-21-23(15)26-24-16(2)10-20(12-22(24)33-21)28-13-17(3)32-18(4)14-28/h9-12,17-18H,5-8,13-14H2,1-4H3,(H2,25,30,31)/q+1/t17-,18-/m1/s1 |
| InChIKey | NWVHDCVCMQAJPT-QZTJIDSGSA-N |
| XLogP | 1.92 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|