C22H29N7O4S — CID 70675983
1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]propyl]-3-(2-ethylphenyl)urea (PubChem CID 70675983) has the molecular formula C22H29N7O4S and a molecular weight of 487.59 g/mol. Its IUPAC name is 1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]propyl]-3-(2-ethylphenyl)urea.
| Compound Name | 1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]propyl]-3-(2-ethylphenyl)urea |
|---|---|
| PubChem CID | 70675983 |
| Molecular Formula | C22H29N7O4S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 1-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]propyl]-3-(2-ethylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)NCCCSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H29N7O4S/c1-2-13-6-3-4-7-14(13)28-22(32)24-8-5-9-34-10-15-17(30)18(31)21(33-15)29-12-27-16-19(23)25-11-26-20(16)29/h3-4,6-7,11-12,15,17-18,21,30-31H,2,5,8-10H2,1H3,(H2,23,25,26)(H2,24,28,32)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | ZUAVYNGHCLODQP-QTQZEZTPSA-N |
| XLogP | 1.54 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|