About [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate
[(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 70676372) has the molecular formula C10H14Cl3NO3
and a molecular weight of 302.59 g/mol. Its IUPAC name is [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate.
Molecular Properties
| Compound Name | [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate |
| PubChem CID | 70676372 |
| Molecular Formula | C10H14Cl3NO3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/C1(O)CCOCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl3NO3/c11-10(12,13)8(14)17-5-1-2-9(15)3-6-16-7-4-9/h1-2,14-15H,3-7H2/b2-1+,14-8+ |
| InChIKey | AXIHWUBCTVVBSF-SSNUUJFHSA-N |
| XLogP | 2.45 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate?
The IUPAC name of [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate (CID 70676372) is [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate.
What is the SMILES notation for [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate?
The canonical SMILES for [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate is [H]/N=C(/OC/C=C/C1(O)CCOCC1)C(Cl)(Cl)Cl.
What is the InChIKey of [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate?
The InChIKey is AXIHWUBCTVVBSF-SSNUUJFHSA-N. The full InChI is InChI=1S/C10H14Cl3NO3/c11-10(12,13)8(14)17-5-1-2-9(15)3-6-16-7-4-9/h1-2,14-15H,3-7H2/b2-1+,14-8+.
What are the key properties of [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate?
[(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate has a molecular weight of 302.59 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(4-hydroxyoxan-4-yl)prop-2-enyl] 2,2,2-trichloroethanimidate is sourced from PubChem (CID 70676372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).