About [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate
[(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 70676518) has the molecular formula C9H14Cl3NO2
and a molecular weight of 274.58 g/mol. Its IUPAC name is [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate.
Molecular Properties
| Compound Name | [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate |
| PubChem CID | 70676518 |
| Molecular Formula | C9H14Cl3NO2 |
| Molecular Weight | 274.58 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C\C(O)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl3NO2/c1-6(2)7(14)4-3-5-15-8(13)9(10,11)12/h3-4,6-7,13-14H,5H2,1-2H3/b4-3-,13-8- |
| InChIKey | CAAVJHLXOMTSOX-XZSWCIGXSA-N |
| XLogP | 2.92 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate?
The IUPAC name of [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate (CID 70676518) is [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate.
What is the SMILES notation for [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate?
The canonical SMILES for [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate is [H]/N=C(\OC/C=C\C(O)C(C)C)C(Cl)(Cl)Cl.
What is the InChIKey of [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate?
The InChIKey is CAAVJHLXOMTSOX-XZSWCIGXSA-N. The full InChI is InChI=1S/C9H14Cl3NO2/c1-6(2)7(14)4-3-5-15-8(13)9(10,11)12/h3-4,6-7,13-14H,5H2,1-2H3/b4-3-,13-8-.
What are the key properties of [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate?
[(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate has a molecular weight of 274.58 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-hydroxy-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate is sourced from PubChem (CID 70676518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).