C14H15ClF3NO4S — CID 70676952
(2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol;methanesulfonic acid (PubChem CID 70676952) has the molecular formula C14H15ClF3NO4S and a molecular weight of 385.79 g/mol. Its IUPAC name is (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol;methanesulfonic acid.
| Compound Name | (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 70676952 |
| Molecular Formula | C14H15ClF3NO4S |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | (2S)-2-(2-amino-5-chlorophenyl)-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Nc1ccc(Cl)cc1[C@@](O)(C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C13H11ClF3NO.CH4O3S/c14-9-3-4-11(18)10(7-9)12(19,13(15,16)17)6-5-8-1-2-8;1-5(2,3)4/h3-4,7-8,19H,1-2,18H2;1H3,(H,2,3,4)/t12-;/m0./s1 |
| InChIKey | HTVLHJBJXPLDQV-YDALLXLXSA-N |
| XLogP | 2.59 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|