C17H15N5S — CID 70677181
6-pyridin-3-yl-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 70677181) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is 6-pyridin-3-yl-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-pyridin-3-yl-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 70677181 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 6-pyridin-3-yl-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(C)c(-c2nnc3sc(-c4cccnc4)nn23)c(C)c1 |
| InChI | InChI=1S/C17H15N5S/c1-10-7-11(2)14(12(3)8-10)15-19-20-17-22(15)21-16(23-17)13-5-4-6-18-9-13/h4-9H,1-3H3 |
| InChIKey | LNNFVYJFUGWCSM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |