C25H26N2O4S — CID 70677249
1'-benzyl-5-methoxy-2-(4-nitrophenyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 70677249) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is 1'-benzyl-5-methoxy-2-(4-nitrophenyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | 1'-benzyl-5-methoxy-2-(4-nitrophenyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 70677249 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1'-benzyl-5-methoxy-2-(4-nitrophenyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | COC1Cc2cc(-c3ccc([N+](=O)[O-])cc3)sc2C2(CCN(Cc3ccccc3)CC2)O1 |
| InChI | InChI=1S/C25H26N2O4S/c1-30-23-16-20-15-22(19-7-9-21(10-8-19)27(28)29)32-24(20)25(31-23)11-13-26(14-12-25)17-18-5-3-2-4-6-18/h2-10,15,23H,11-14,16-17H2,1H3 |
| InChIKey | XHDOQVPXSMNFMM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|