C30H26O4 — CID 70677300
4-[(2R,3R)-3-(4-methoxyphenyl)-5-[(E)-2-(4-methoxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-2-yl]phenol (PubChem CID 70677300) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is 4-[(2R,3R)-3-(4-methoxyphenyl)-5-[(E)-2-(4-methoxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-2-yl]phenol.
| Compound Name | 4-[(2R,3R)-3-(4-methoxyphenyl)-5-[(E)-2-(4-methoxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-2-yl]phenol |
|---|---|
| PubChem CID | 70677300 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-[(2R,3R)-3-(4-methoxyphenyl)-5-[(E)-2-(4-methoxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-2-yl]phenol |
| SMILES | COc1ccc(/C=C/c2ccc3c(c2)[C@@H](c2ccc(OC)cc2)[C@H](c2ccc(O)cc2)O3)cc1 |
| InChI | InChI=1S/C30H26O4/c1-32-25-14-5-20(6-15-25)3-4-21-7-18-28-27(19-21)29(22-10-16-26(33-2)17-11-22)30(34-28)23-8-12-24(31)13-9-23/h3-19,29-31H,1-2H3/b4-3+/t29-,30+/m1/s1 |
| InChIKey | WOXTXHGEZDZTLT-CJWQTPIZSA-N |
| XLogP | 6.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|