About 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole
5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole (PubChem CID 70677559) has the molecular formula C24H18ClN
and a molecular weight of 355.87 g/mol. Its IUPAC name is 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole.
Molecular Properties
| Compound Name | 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole |
| PubChem CID | 70677559 |
| Molecular Formula | C24H18ClN |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole |
| SMILES | CC(C#Cc1ccccc1)(c1ccccc1)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H18ClN/c1-24(19-10-6-3-7-11-19,15-14-18-8-4-2-5-9-18)22-17-26-23-13-12-20(25)16-21(22)23/h2-13,16-17,26H,1H3 |
| InChIKey | DXVINEFHNDBICU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole?
The IUPAC name of 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole (CID 70677559) is 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole.
What is the SMILES notation for 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole?
The canonical SMILES for 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole is CC(C#Cc1ccccc1)(c1ccccc1)c1c[nH]c2ccc(Cl)cc12.
What is the InChIKey of 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole?
The InChIKey is DXVINEFHNDBICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18ClN/c1-24(19-10-6-3-7-11-19,15-14-18-8-4-2-5-9-18)22-17-26-23-13-12-20(25)16-21(22)23/h2-13,16-17,26H,1H3.
What are the key properties of 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole?
5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole has a molecular weight of 355.87 g/mol, XLogP of 6.18, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2,4-diphenylbut-3-yn-2-yl)-1H-indole is sourced from PubChem (CID 70677559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).