About 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol
2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 706783) has the molecular formula C14H9FN2O2
and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol |
| PubChem CID | 706783 |
| Molecular Formula | C14H9FN2O2 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nnc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C14H9FN2O2/c15-10-7-5-9(6-8-10)13-16-17-14(19-13)11-3-1-2-4-12(11)18/h1-8,18H |
| InChIKey | DSFIZGIEGFGZOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol?
The IUPAC name of 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol (CID 706783) is 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol.
What is the SMILES notation for 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol?
The canonical SMILES for 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol is Oc1ccccc1-c1nnc(-c2ccc(F)cc2)o1.
What is the InChIKey of 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol?
The InChIKey is DSFIZGIEGFGZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2O2/c15-10-7-5-9(6-8-10)13-16-17-14(19-13)11-3-1-2-4-12(11)18/h1-8,18H.
What are the key properties of 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol?
2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol has a molecular weight of 256.24 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]phenol is sourced from PubChem (CID 706783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).