C40H40N8O4Si — CID 70678524
4-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate (PubChem CID 70678524) has the molecular formula C40H40N8O4Si and a molecular weight of 724.90 g/mol. Its IUPAC name is 4-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate.
| Compound Name | 4-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate |
|---|---|
| PubChem CID | 70678524 |
| Molecular Formula | C40H40N8O4Si |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.29 |
| IUPAC Name | 4-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methylcarbamoyl]-2-[7-(dimethylamino)-3-dimethylazaniumylidene-5,5-dimethylbenzo[b][1]benzosilin-10-yl]benzoate |
| SMILES | CN(C)c1ccc2c(c1)[Si](C)(C)C1=CC(=[N+](C)C)C=CC1=C2c1cc(C(=O)NCc2ccc(COc3nc(N)nc4nc[nH]c34)cc2)ccc1C(=O)[O-] |
| InChI | InChI=1S/C40H40N8O4Si/c1-47(2)26-12-15-29-32(18-26)53(5,6)33-19-27(48(3)4)13-16-30(33)34(29)31-17-25(11-14-28(31)39(50)51)37(49)42-20-23-7-9-24(10-8-23)21-52-38-35-36(44-22-43-35)45-40(41)46-38/h7-19,22H,20-21H2,1-6H3,(H4-,41,42,43,44,45,46,49,50,51) |
| InChIKey | MEQDWNGGJMKXNG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 165.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|