C8H10O2 — CID 70678836
(2E,4E,6E)-7-hydroxy-4-methylhepta-2,4,6-trienal (PubChem CID 70678836) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (2E,4E,6E)-7-hydroxy-4-methylhepta-2,4,6-trienal.
| Compound Name | (2E,4E,6E)-7-hydroxy-4-methylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 70678836 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (2E,4E,6E)-7-hydroxy-4-methylhepta-2,4,6-trienal |
| SMILES | CC(/C=C/C=O)=C\C=C\O |
| InChI | InChI=1S/C8H10O2/c1-8(4-2-6-9)5-3-7-10/h2-7,9H,1H3/b5-3+,6-2+,8-4+ |
| InChIKey | TYQZWSFEJJSSQR-YUHMVAQCSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|