C15H21O2- — CID 70678894
(1R,2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carboxylate (PubChem CID 70678894) has the molecular formula C15H21O2- and a molecular weight of 233.33 g/mol. Its IUPAC name is (1R,2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carboxylate.
| Compound Name | (1R,2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 70678894 |
| Molecular Formula | C15H21O2- |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (1R,2R,5R,8S)-2,10,10-trimethyltricyclo[6.3.0.01,5]undec-6-ene-6-carboxylate |
| SMILES | C[C@@H]1CC[C@H]2C(C(=O)[O-])=C[C@@H]3CC(C)(C)C[C@@]132 |
| InChI | InChI=1S/C15H22O2/c1-9-4-5-12-11(13(16)17)6-10-7-14(2,3)8-15(9,10)12/h6,9-10,12H,4-5,7-8H2,1-3H3,(H,16,17)/p-1/t9-,10-,12+,15-/m1/s1 |
| InChIKey | DCFDRCCHOOORSB-DSKWVYQCSA-M |
| XLogP | 2.14 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |