About acetamidomethylazanium
acetamidomethylazanium (PubChem CID 70679062) has the molecular formula C3H9N2O+
and a molecular weight of 89.12 g/mol. Its IUPAC name is acetamidomethylazanium.
Molecular Properties
| Compound Name | acetamidomethylazanium |
| PubChem CID | 70679062 |
| Molecular Formula | C3H9N2O+ |
| Molecular Weight | 89.12 g/mol |
| Exact Mass | 89.07 |
| IUPAC Name | acetamidomethylazanium |
| SMILES | CC(=O)NC[NH3+] |
| InChI | InChI=1S/C3H8N2O/c1-3(6)5-2-4/h2,4H2,1H3,(H,5,6)/p+1 |
| InChIKey | BLMIGVQIUUGRMY-UHFFFAOYSA-O |
| XLogP | -1.68 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.12 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetamidomethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamidomethylazanium?
The IUPAC name of acetamidomethylazanium (CID 70679062) is acetamidomethylazanium.
What is the SMILES notation for acetamidomethylazanium?
The canonical SMILES for acetamidomethylazanium is CC(=O)NC[NH3+].
What is the InChIKey of acetamidomethylazanium?
The InChIKey is BLMIGVQIUUGRMY-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H8N2O/c1-3(6)5-2-4/h2,4H2,1H3,(H,5,6)/p+1.
What are the key properties of acetamidomethylazanium?
acetamidomethylazanium has a molecular weight of 89.12 g/mol, XLogP of -1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamidomethylazanium is sourced from PubChem (CID 70679062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).