About kappa-H3(Cat-EDT-ST)2
kappa-H3(Cat-EDT-ST)2 (PubChem CID 70679330) has the molecular formula C24H15O4S10Se2
and a molecular weight of 845.97 g/mol.
Molecular Properties
| Compound Name | kappa-H3(Cat-EDT-ST)2 |
| PubChem CID | 70679330 |
| Molecular Formula | C24H15O4S10Se2 |
| Molecular Weight | 845.97 g/mol |
| Exact Mass | 846.65 |
| IUPAC Name | — |
| SMILES | Oc1cc2c(cc1O)SC(=C1SC3=C(SCCS3)S1)S2.[O-]c1cc2c(cc1O)S[C](c1[se]c3c([se+]1)SCCS3)S2 |
| InChI | InChI=1S/C12H8O2S6.C12H7O2S4Se2/c13-5-3-7-8(4-6(5)14)18-11(17-7)12-19-9-10(20-12)16-2-1-15-9;13-5-3-7-8(4-6(5)14)18-9(17-7)12-19-10-11(20-12)16-2-1-15-10/h3-4,13-14H,1-2H2;3-4H,1-2H2,(H-,13,14) |
| InChIKey | HPMVJHQBJHTBIR-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 845.97 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze kappa-H3(Cat-EDT-ST)2 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of kappa-H3(Cat-EDT-ST)2?
The IUPAC name of kappa-H3(Cat-EDT-ST)2 (CID 70679330) is not available.
What is the SMILES notation for kappa-H3(Cat-EDT-ST)2?
The canonical SMILES for kappa-H3(Cat-EDT-ST)2 is Oc1cc2c(cc1O)SC(=C1SC3=C(SCCS3)S1)S2.[O-]c1cc2c(cc1O)S[C](c1[se]c3c([se+]1)SCCS3)S2.
What is the InChIKey of kappa-H3(Cat-EDT-ST)2?
The InChIKey is HPMVJHQBJHTBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2S6.C12H7O2S4Se2/c13-5-3-7-8(4-6(5)14)18-11(17-7)12-19-9-10(20-12)16-2-1-15-9;13-5-3-7-8(4-6(5)14)18-9(17-7)12-19-10-11(20-12)16-2-1-15-10/h3-4,13-14H,1-2H2;3-4H,1-2H2,(H-,13,14).
What are the key properties of kappa-H3(Cat-EDT-ST)2?
kappa-H3(Cat-EDT-ST)2 has a molecular weight of 845.97 g/mol, XLogP of 8.30, 1 rotatable bonds, 3 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for kappa-H3(Cat-EDT-ST)2 is sourced from PubChem (CID 70679330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).