About CID 70679331
CID 70679331 (PubChem CID 70679331) has the molecular formula C12H8O2S6+
and a molecular weight of 376.60 g/mol.
Molecular Properties
| Compound Name | CID 70679331 |
| PubChem CID | 70679331 |
| Molecular Formula | C12H8O2S6+ |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 375.88 |
| IUPAC Name | — |
| SMILES | Oc1cc2c(cc1O)S[C](c1sc3c([s+]1)SCCS3)S2 |
| InChI | InChI=1S/C12H7O2S6/c13-5-3-7-8(4-6(5)14)18-11(17-7)12-19-9-10(20-12)16-2-1-15-9/h3-4H,1-2H2,(H-,13,14)/p+1 |
| InChIKey | ZUWRXLLRODEXOG-UHFFFAOYSA-O |
| XLogP | 5.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 70679331 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70679331?
The IUPAC name of CID 70679331 (CID 70679331) is not available.
What is the SMILES notation for CID 70679331?
The canonical SMILES for CID 70679331 is Oc1cc2c(cc1O)S[C](c1sc3c([s+]1)SCCS3)S2.
What is the InChIKey of CID 70679331?
The InChIKey is ZUWRXLLRODEXOG-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H7O2S6/c13-5-3-7-8(4-6(5)14)18-11(17-7)12-19-9-10(20-12)16-2-1-15-9/h3-4H,1-2H2,(H-,13,14)/p+1.
What are the key properties of CID 70679331?
CID 70679331 has a molecular weight of 376.60 g/mol, XLogP of 5.44, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70679331 is sourced from PubChem (CID 70679331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).