C12H8O2S6 — CID 70679333
2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol (PubChem CID 70679333) has the molecular formula C12H8O2S6 and a molecular weight of 376.60 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol.
| Compound Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol |
|---|---|
| PubChem CID | 70679333 |
| Molecular Formula | C12H8O2S6 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 375.88 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol |
| SMILES | Oc1cc2c(cc1O)SC(=C1SC3=C(SCCS3)S1)S2 |
| InChI | InChI=1S/C12H8O2S6/c13-5-3-7-8(4-6(5)14)18-11(17-7)12-19-9-10(20-12)16-2-1-15-9/h3-4,13-14H,1-2H2 |
| InChIKey | YIEQXOZUIKYYER-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|