About tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate
tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate (PubChem CID 70679492) has the molecular formula C17H22O4S
and a molecular weight of 322.43 g/mol. Its IUPAC name is tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate |
| PubChem CID | 70679492 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1[C@H](O)C=CC[C@H]1S(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O4S/c1-17(2,3)21-16(19)15-13(18)10-7-11-14(15)22(20)12-8-5-4-6-9-12/h4-10,13-15,18H,11H2,1-3H3/t13-,14-,15?,22?/m1/s1 |
| InChIKey | YFMRZADBMFZXPC-MNJSFFNPSA-N |
| XLogP | 2.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate?
The IUPAC name of tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate (CID 70679492) is tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate?
The canonical SMILES for tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate is CC(C)(C)OC(=O)C1[C@H](O)C=CC[C@H]1S(=O)c1ccccc1.
What is the InChIKey of tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate?
The InChIKey is YFMRZADBMFZXPC-MNJSFFNPSA-N. The full InChI is InChI=1S/C17H22O4S/c1-17(2,3)21-16(19)15-13(18)10-7-11-14(15)22(20)12-8-5-4-6-9-12/h4-10,13-15,18H,11H2,1-3H3/t13-,14-,15?,22?/m1/s1.
What are the key properties of tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate?
tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate has a molecular weight of 322.43 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,6R)-6-(benzenesulfinyl)-2-hydroxycyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 70679492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).