C27H44O4 — CID 70679524
(7S,18S)-16-hydroxy-6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-19-one (PubChem CID 70679524) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (7S,18S)-16-hydroxy-6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-19-one.
| Compound Name | (7S,18S)-16-hydroxy-6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-19-one |
|---|---|
| PubChem CID | 70679524 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (7S,18S)-16-hydroxy-6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-19-one |
| SMILES | CC(CO)CCC1OC2CC3C4CC(=O)[C@H]5CC(O)CCC5(C)C4CCC3(C)C2C1C |
| InChI | InChI=1S/C27H44O4/c1-15(14-28)5-6-23-16(2)25-24(31-23)13-20-18-12-22(30)21-11-17(29)7-9-26(21,3)19(18)8-10-27(20,25)4/h15-21,23-25,28-29H,5-14H2,1-4H3/t15?,16?,17?,18?,19?,20?,21-,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | UYHUMSBFPJXYQT-GYWHLAHWSA-N |
| XLogP | 4.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |