C28H33N3O3 — CID 70679996
(2R,3Z,7S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pentylidene-7-phenyl-2-propan-2-yl-6,7-dihydro-2H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 70679996) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2R,3Z,7S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pentylidene-7-phenyl-2-propan-2-yl-6,7-dihydro-2H-imidazo[1,2-a]pyrimidin-5-one.
| Compound Name | (2R,3Z,7S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pentylidene-7-phenyl-2-propan-2-yl-6,7-dihydro-2H-imidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 70679996 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | (2R,3Z,7S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pentylidene-7-phenyl-2-propan-2-yl-6,7-dihydro-2H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCC/C=C1/[C@@H](C(C)C)N(Cc2ccc3c(c2)OCO3)C2=N[C@H](c3ccccc3)CC(=O)N21 |
| InChI | InChI=1S/C28H33N3O3/c1-4-5-7-12-23-27(19(2)3)30(17-20-13-14-24-25(15-20)34-18-33-24)28-29-22(16-26(32)31(23)28)21-10-8-6-9-11-21/h6,8-15,19,22,27H,4-5,7,16-18H2,1-3H3/b23-12-/t22-,27+/m0/s1 |
| InChIKey | MDKXXWMSPMWKJE-LVGXGLHDSA-N |
| XLogP | 5.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|