C37H28N4O6 — CID 70680048
2-[2-[2-[(3R)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-6-methoxy-2-oxo-1H-indol-3-yl]-1H-indol-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 70680048) has the molecular formula C37H28N4O6 and a molecular weight of 624.65 g/mol. Its IUPAC name is 2-[2-[2-[(3R)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-6-methoxy-2-oxo-1H-indol-3-yl]-1H-indol-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[(3R)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-6-methoxy-2-oxo-1H-indol-3-yl]-1H-indol-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70680048 |
| Molecular Formula | C37H28N4O6 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | 2-[2-[2-[(3R)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-6-methoxy-2-oxo-1H-indol-3-yl]-1H-indol-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)NC(=O)[C@@]2(CCN1C(=O)c2ccccc2C1=O)c1[nH]c2ccccc2c1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H28N4O6/c1-47-21-14-15-28-30(20-21)39-36(46)37(28,17-19-41-34(44)26-11-4-5-12-27(26)35(41)45)31-23(22-8-6-7-13-29(22)38-31)16-18-40-32(42)24-9-2-3-10-25(24)33(40)43/h2-15,20,38H,16-19H2,1H3,(H,39,46)/t37-/m1/s1 |
| InChIKey | PXQQCKZQFWNQAV-DIPNUNPCSA-N |
| XLogP | 4.94 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|