C22H27NO5 — CID 70680102
(1S,2S,3S,4S,7R,10R,13S,17R)-N-cyclopropyl-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide (PubChem CID 70680102) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (1S,2S,3S,4S,7R,10R,13S,17R)-N-cyclopropyl-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide.
| Compound Name | (1S,2S,3S,4S,7R,10R,13S,17R)-N-cyclopropyl-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide |
|---|---|
| PubChem CID | 70680102 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (1S,2S,3S,4S,7R,10R,13S,17R)-N-cyclopropyl-13,17-dihydroxy-4-methyl-14-methylidene-5-oxo-6-oxapentacyclo[11.2.1.14,7.01,10.03,9]heptadec-8-ene-2-carboxamide |
| SMILES | C=C1C[C@]23C[C@@]1(O)CC[C@H]2C1=C[C@H]2OC(=O)[C@@](C)([C@H]1[C@@H]3C(=O)NC1CC1)[C@H]2O |
| InChI | InChI=1S/C22H27NO5/c1-10-8-21-9-22(10,27)6-5-13(21)12-7-14-17(24)20(2,19(26)28-14)15(12)16(21)18(25)23-11-3-4-11/h7,11,13-17,24,27H,1,3-6,8-9H2,2H3,(H,23,25)/t13-,14+,15+,16+,17-,20-,21-,22-/m0/s1 |
| InChIKey | NASFVSBFCKWEIA-JJQQDXTCSA-N |
| XLogP | 1.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|