C12H8O2S4Se2 — CID 70680202
2-(5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol (PubChem CID 70680202) has the molecular formula C12H8O2S4Se2 and a molecular weight of 470.38 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol.
| Compound Name | 2-(5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol |
|---|---|
| PubChem CID | 70680202 |
| Molecular Formula | C12H8O2S4Se2 |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 471.77 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]diselenolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-benzodithiole-5,6-diol |
| SMILES | Oc1cc2c(cc1O)SC(=C1[Se]C3=C(SCCS3)[Se]1)S2 |
| InChI | InChI=1S/C12H8O2S4Se2/c13-5-3-7-8(4-6(5)14)18-9(17-7)12-19-10-11(20-12)16-2-1-15-10/h3-4,13-14H,1-2H2 |
| InChIKey | GSEKICOKVWWEFX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|