C19H23N3O4S — CID 70680204
1-methyl-2-oxo-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]pyridine-4-carboxamide (PubChem CID 70680204) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70680204 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-methyl-2-oxo-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]pyridine-4-carboxamide |
| SMILES | Cn1ccc(C(=O)NCc2cccc(S(=O)(=O)N3CCCCC3)c2)cc1=O |
| InChI | InChI=1S/C19H23N3O4S/c1-21-11-8-16(13-18(21)23)19(24)20-14-15-6-5-7-17(12-15)27(25,26)22-9-3-2-4-10-22/h5-8,11-13H,2-4,9-10,14H2,1H3,(H,20,24) |
| InChIKey | WRFQTRYYFBANOK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |