About (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione
(6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione (PubChem CID 70680587) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione |
| PubChem CID | 70680587 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)[C@H](CCC(C)C)C(C)C1=O |
| InChI | InChI=1S/C14H22O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h8-10H,6-7H2,1-5H3/t9?,10-/m1/s1 |
| InChIKey | GTBFTJOLTOIEQL-QVDQXJPCSA-N |
| XLogP | 2.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione?
The IUPAC name of (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione (CID 70680587) is (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione.
What is the SMILES notation for (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione?
The canonical SMILES for (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione is COC1=C(OC)C(=O)[C@H](CCC(C)C)C(C)C1=O.
What is the InChIKey of (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione?
The InChIKey is GTBFTJOLTOIEQL-QVDQXJPCSA-N. The full InChI is InChI=1S/C14H22O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h8-10H,6-7H2,1-5H3/t9?,10-/m1/s1.
What are the key properties of (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione?
(6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione has a molecular weight of 254.33 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,3-dimethoxy-5-methyl-6-(3-methylbutyl)cyclohex-2-ene-1,4-dione is sourced from PubChem (CID 70680587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).