C28H43N5O3 — CID 70681001
tert-butyl N-[7-[[3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carbonyl]amino]heptyl]carbamate (PubChem CID 70681001) has the molecular formula C28H43N5O3 and a molecular weight of 497.68 g/mol. Its IUPAC name is tert-butyl N-[7-[[3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carbonyl]amino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[[3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carbonyl]amino]heptyl]carbamate |
|---|---|
| PubChem CID | 70681001 |
| Molecular Formula | C28H43N5O3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | tert-butyl N-[7-[[3-methyl-2-(4-methylpiperazin-1-yl)quinoline-4-carbonyl]amino]heptyl]carbamate |
| SMILES | Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H43N5O3/c1-21-24(22-13-9-10-14-23(22)31-25(21)33-19-17-32(5)18-20-33)26(34)29-15-11-7-6-8-12-16-30-27(35)36-28(2,3)4/h9-10,13-14H,6-8,11-12,15-20H2,1-5H3,(H,29,34)(H,30,35) |
| InChIKey | PWYWGJDVCMKQQI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|