C25H29NO2 — CID 70681077
(3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 70681077) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 70681077 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-5-ethyl-3,6-dimethyl-4-[(E)-2-(5-phenyl-2-pyridinyl)ethenyl]-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CC[C@H]1[C@H](/C=C/c2ccc(-c3ccccc3)cn2)[C@@H]2[C@@H](C)OC(=O)[C@@H]2C[C@@H]1C |
| InChI | InChI=1S/C25H29NO2/c1-4-21-16(2)14-23-24(17(3)28-25(23)27)22(21)13-12-20-11-10-19(15-26-20)18-8-6-5-7-9-18/h5-13,15-17,21-24H,4,14H2,1-3H3/b13-12+/t16-,17+,21+,22-,23+,24-/m0/s1 |
| InChIKey | PNANYOZXILVVCJ-YJEKUMCOSA-N |
| XLogP | 5.62 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |