C16H22ClN5O2 — CID 70681088
(1R,2R,3S,4R,5S)-4-[2-chloro-6-(pentan-3-ylamino)purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 70681088) has the molecular formula C16H22ClN5O2 and a molecular weight of 351.84 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[2-chloro-6-(pentan-3-ylamino)purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[2-chloro-6-(pentan-3-ylamino)purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 70681088 |
| Molecular Formula | C16H22ClN5O2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[2-chloro-6-(pentan-3-ylamino)purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | CCC(CC)Nc1nc(Cl)nc2c1ncn2[C@H]1[C@H](O)[C@H](O)[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C16H22ClN5O2/c1-3-7(4-2)19-14-10-15(21-16(17)20-14)22(6-18-10)11-8-5-9(8)12(23)13(11)24/h6-9,11-13,23-24H,3-5H2,1-2H3,(H,19,20,21)/t8-,9+,11+,12+,13-/m0/s1 |
| InChIKey | SKWTZWKZAJNAQW-AMGFRPDHSA-N |
| XLogP | 1.99 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |