C40H39N3O9 — CID 70681102
(7-methoxy-2-oxochromen-4-yl)methyl 6-[4-[[4-[2,3-dihydroxy-4-(4-hydroxyphenyl)-5,6-dimethylphenyl]phenoxy]methyl]triazol-1-yl]hexanoate (PubChem CID 70681102) has the molecular formula C40H39N3O9 and a molecular weight of 705.76 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 6-[4-[[4-[2,3-dihydroxy-4-(4-hydroxyphenyl)-5,6-dimethylphenyl]phenoxy]methyl]triazol-1-yl]hexanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 6-[4-[[4-[2,3-dihydroxy-4-(4-hydroxyphenyl)-5,6-dimethylphenyl]phenoxy]methyl]triazol-1-yl]hexanoate |
|---|---|
| PubChem CID | 70681102 |
| Molecular Formula | C40H39N3O9 |
| Molecular Weight | 705.76 g/mol |
| Exact Mass | 705.27 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 6-[4-[[4-[2,3-dihydroxy-4-(4-hydroxyphenyl)-5,6-dimethylphenyl]phenoxy]methyl]triazol-1-yl]hexanoate |
| SMILES | COc1ccc2c(COC(=O)CCCCCn3cc(COc4ccc(-c5c(C)c(C)c(-c6ccc(O)cc6)c(O)c5O)cc4)nn3)cc(=O)oc2c1 |
| InChI | InChI=1S/C40H39N3O9/c1-24-25(2)38(40(48)39(47)37(24)26-8-12-30(44)13-9-26)27-10-14-31(15-11-27)50-23-29-21-43(42-41-29)18-6-4-5-7-35(45)51-22-28-19-36(46)52-34-20-32(49-3)16-17-33(28)34/h8-17,19-21,44,47-48H,4-7,18,22-23H2,1-3H3 |
| InChIKey | GLWAIBMVQLLVHS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 166.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.76 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|