About 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene
1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene (PubChem CID 70681110) has the molecular formula C17H18Br2O4
and a molecular weight of 446.14 g/mol. Its IUPAC name is 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene |
| PubChem CID | 70681110 |
| Molecular Formula | C17H18Br2O4 |
| Molecular Weight | 446.14 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(Cc2cc(OC)c(OC)cc2Br)cc1OC |
| InChI | InChI=1S/C17H18Br2O4/c1-20-14-6-10(12(18)8-16(14)22-3)5-11-7-15(21-2)17(23-4)9-13(11)19/h6-9H,5H2,1-4H3 |
| InChIKey | OXXBLAGYPJUTSN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene?
The IUPAC name of 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene (CID 70681110) is 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene.
What is the SMILES notation for 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene?
The canonical SMILES for 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene is COc1cc(Br)c(Cc2cc(OC)c(OC)cc2Br)cc1OC.
What is the InChIKey of 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene?
The InChIKey is OXXBLAGYPJUTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Br2O4/c1-20-14-6-10(12(18)8-16(14)22-3)5-11-7-15(21-2)17(23-4)9-13(11)19/h6-9H,5H2,1-4H3.
What are the key properties of 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene?
1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene has a molecular weight of 446.14 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4,5-dimethoxybenzene is sourced from PubChem (CID 70681110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).