About 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one
2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one (PubChem CID 70681128) has the molecular formula C18H19NOS
and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one |
| PubChem CID | 70681128 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one |
| SMILES | O=C1CCC2(CCCCC2)c2sc(-c3ccncc3)cc21 |
| InChI | InChI=1S/C18H19NOS/c20-15-4-9-18(7-2-1-3-8-18)17-14(15)12-16(21-17)13-5-10-19-11-6-13/h5-6,10-12H,1-4,7-9H2 |
| InChIKey | WPADQSHTSUGGIR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one?
The IUPAC name of 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one (CID 70681128) is 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one.
What is the SMILES notation for 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one?
The canonical SMILES for 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one is O=C1CCC2(CCCCC2)c2sc(-c3ccncc3)cc21.
What is the InChIKey of 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one?
The InChIKey is WPADQSHTSUGGIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NOS/c20-15-4-9-18(7-2-1-3-8-18)17-14(15)12-16(21-17)13-5-10-19-11-6-13/h5-6,10-12H,1-4,7-9H2.
What are the key properties of 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one?
2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one has a molecular weight of 297.42 g/mol, XLogP of 4.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-ylspiro[5,6-dihydro-1-benzothiophene-7,1'-cyclohexane]-4-one is sourced from PubChem (CID 70681128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).