About 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid
3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 70681225) has the molecular formula C25H19NO4
and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 70681225 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(CC(C(=O)c3ccccc3)c3ccccc3)cc2)no1 |
| InChI | InChI=1S/C25H19NO4/c27-24(20-9-5-2-6-10-20)21(18-7-3-1-4-8-18)15-17-11-13-19(14-12-17)22-16-23(25(28)29)30-26-22/h1-14,16,21H,15H2,(H,28,29) |
| InChIKey | HBYWCGDPKWGHBS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid (CID 70681225) is 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(-c2ccc(CC(C(=O)c3ccccc3)c3ccccc3)cc2)no1.
What is the InChIKey of 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is HBYWCGDPKWGHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19NO4/c27-24(20-9-5-2-6-10-20)21(18-7-3-1-4-8-18)15-17-11-13-19(14-12-17)22-16-23(25(28)29)30-26-22/h1-14,16,21H,15H2,(H,28,29).
What are the key properties of 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid?
3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 397.43 g/mol, XLogP of 5.25, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-oxo-2,3-diphenylpropyl)phenyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 70681225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).